C14H20N2O3 — CID 134475928
N-[(2E,4Z,6E)-5-cyano-4-(2-methoxyethoxy)nona-2,4,6-trien-2-yl]formamide (PubChem CID 134475928) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-[(2E,4Z,6E)-5-cyano-4-(2-methoxyethoxy)nona-2,4,6-trien-2-yl]formamide.
| Compound Name | N-[(2E,4Z,6E)-5-cyano-4-(2-methoxyethoxy)nona-2,4,6-trien-2-yl]formamide |
|---|---|
| PubChem CID | 134475928 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-[(2E,4Z,6E)-5-cyano-4-(2-methoxyethoxy)nona-2,4,6-trien-2-yl]formamide |
| SMILES | CC/C=C/C(C#N)=C(\C=C(/C)NC=O)OCCOC |
| InChI | InChI=1S/C14H20N2O3/c1-4-5-6-13(10-15)14(19-8-7-18-3)9-12(2)16-11-17/h5-6,9,11H,4,7-8H2,1-3H3,(H,16,17)/b6-5+,12-9+,14-13- |
| InChIKey | BLAGSEJQSGJFRX-LFVIEXCVSA-N |
| XLogP | 2.04 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|