About (5E)-5-ethylidene-3,4-dimethyl-4H-imidazole
(5E)-5-ethylidene-3,4-dimethyl-4H-imidazole (PubChem CID 134476232) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is (5E)-5-ethylidene-3,4-dimethyl-4H-imidazole.
Molecular Properties
| Compound Name | (5E)-5-ethylidene-3,4-dimethyl-4H-imidazole |
| PubChem CID | 134476232 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (5E)-5-ethylidene-3,4-dimethyl-4H-imidazole |
| SMILES | C/C=C1/N=CN(C)C1C |
| InChI | InChI=1S/C7H12N2/c1-4-7-6(2)9(3)5-8-7/h4-6H,1-3H3/b7-4+ |
| InChIKey | HHSHVSZWFQBXGG-QPJJXVBHSA-N |
| XLogP | 1.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5E)-5-ethylidene-3,4-dimethyl-4H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-ethylidene-3,4-dimethyl-4H-imidazole?
The IUPAC name of (5E)-5-ethylidene-3,4-dimethyl-4H-imidazole (CID 134476232) is (5E)-5-ethylidene-3,4-dimethyl-4H-imidazole.
What is the SMILES notation for (5E)-5-ethylidene-3,4-dimethyl-4H-imidazole?
The canonical SMILES for (5E)-5-ethylidene-3,4-dimethyl-4H-imidazole is C/C=C1/N=CN(C)C1C.
What is the InChIKey of (5E)-5-ethylidene-3,4-dimethyl-4H-imidazole?
The InChIKey is HHSHVSZWFQBXGG-QPJJXVBHSA-N. The full InChI is InChI=1S/C7H12N2/c1-4-7-6(2)9(3)5-8-7/h4-6H,1-3H3/b7-4+.
What are the key properties of (5E)-5-ethylidene-3,4-dimethyl-4H-imidazole?
(5E)-5-ethylidene-3,4-dimethyl-4H-imidazole has a molecular weight of 124.19 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-ethylidene-3,4-dimethyl-4H-imidazole is sourced from PubChem (CID 134476232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).