About 5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one
5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one (PubChem CID 13447635) has the molecular formula C16H15NO
and a molecular weight of 237.30 g/mol. Its IUPAC name is 5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one.
Molecular Properties
| Compound Name | 5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one |
| PubChem CID | 13447635 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one |
| SMILES | CN1C(=O)c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C16H15NO/c1-17-15-9-5-3-7-13(15)11-10-12-6-2-4-8-14(12)16(17)18/h2-9H,10-11H2,1H3 |
| InChIKey | WSTOHEQUNKZOFY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one?
The IUPAC name of 5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one (CID 13447635) is 5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one.
What is the SMILES notation for 5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one?
The canonical SMILES for 5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one is CN1C(=O)c2ccccc2CCc2ccccc21.
What is the InChIKey of 5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one?
The InChIKey is WSTOHEQUNKZOFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO/c1-17-15-9-5-3-7-13(15)11-10-12-6-2-4-8-14(12)16(17)18/h2-9H,10-11H2,1H3.
What are the key properties of 5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one?
5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one has a molecular weight of 237.30 g/mol, XLogP of 3.06, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-11,12-dihydrobenzo[c][1]benzazocin-6-one is sourced from PubChem (CID 13447635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).