C32H31FN4O5 — CID 134476361
5-[3-(4-fluorophenyl)-7-[5-[(8Z)-6-methyl-4-methylidene-5,6,7,10-tetrahydro-1,3-oxazecin-2-yl]-1,2-oxazol-3-yl]-4-oxoquinazolin-2-yl]pentanoic acid (PubChem CID 134476361) has the molecular formula C32H31FN4O5 and a molecular weight of 570.62 g/mol. Its IUPAC name is 5-[3-(4-fluorophenyl)-7-[5-[(8Z)-6-methyl-4-methylidene-5,6,7,10-tetrahydro-1,3-oxazecin-2-yl]-1,2-oxazol-3-yl]-4-oxoquinazolin-2-yl]pentanoic acid.
| Compound Name | 5-[3-(4-fluorophenyl)-7-[5-[(8Z)-6-methyl-4-methylidene-5,6,7,10-tetrahydro-1,3-oxazecin-2-yl]-1,2-oxazol-3-yl]-4-oxoquinazolin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 134476361 |
| Molecular Formula | C32H31FN4O5 |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 5-[3-(4-fluorophenyl)-7-[5-[(8Z)-6-methyl-4-methylidene-5,6,7,10-tetrahydro-1,3-oxazecin-2-yl]-1,2-oxazol-3-yl]-4-oxoquinazolin-2-yl]pentanoic acid |
| SMILES | C=C1CC(C)C/C=C\CO/C(c2cc(-c3ccc4c(=O)n(-c5ccc(F)cc5)c(CCCCC(=O)O)nc4c3)no2)=N\1 |
| InChI | InChI=1S/C32H31FN4O5/c1-20-7-5-6-16-41-31(34-21(2)17-20)28-19-26(36-42-28)22-10-15-25-27(18-22)35-29(8-3-4-9-30(38)39)37(32(25)40)24-13-11-23(33)12-14-24/h5-6,10-15,18-20H,2-4,7-9,16-17H2,1H3,(H,38,39)/b6-5-,34-31- |
| InChIKey | BYMIKSATGFTESF-QIAKJQTLSA-N |
| XLogP | 6.24 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|