C38H29N5 — CID 134476705
5-(3-tert-butylcarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 134476705) has the molecular formula C38H29N5 and a molecular weight of 555.69 g/mol. Its IUPAC name is 5-(3-tert-butylcarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 5-(3-tert-butylcarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 134476705 |
| Molecular Formula | C38H29N5 |
| Molecular Weight | 555.69 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | 5-(3-tert-butylcarbazol-9-yl)-2-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | CC(C)(C)c1ccc2c(c1)c1ccccc1n2-c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c(C#N)c1 |
| InChI | InChI=1S/C38H29N5/c1-38(2,3)28-18-21-34-32(23-28)31-16-10-11-17-33(31)43(34)29-19-20-30(27(22-29)24-39)37-41-35(25-12-6-4-7-13-25)40-36(42-37)26-14-8-5-9-15-26/h4-23H,1-3H3 |
| InChIKey | AASWWQOCACFFNW-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.69 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |