C27H29N5O4S — CID 134476924
(3-methoxyazetidin-1-yl)-[3-methoxy-4-[[6-[1-(methoxymethylsulfanylmethyl)pyrazol-4-yl]isoquinolin-3-yl]amino]phenyl]methanone (PubChem CID 134476924) has the molecular formula C27H29N5O4S and a molecular weight of 519.63 g/mol. Its IUPAC name is (3-methoxyazetidin-1-yl)-[3-methoxy-4-[[6-[1-(methoxymethylsulfanylmethyl)pyrazol-4-yl]isoquinolin-3-yl]amino]phenyl]methanone.
| Compound Name | (3-methoxyazetidin-1-yl)-[3-methoxy-4-[[6-[1-(methoxymethylsulfanylmethyl)pyrazol-4-yl]isoquinolin-3-yl]amino]phenyl]methanone |
|---|---|
| PubChem CID | 134476924 |
| Molecular Formula | C27H29N5O4S |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | (3-methoxyazetidin-1-yl)-[3-methoxy-4-[[6-[1-(methoxymethylsulfanylmethyl)pyrazol-4-yl]isoquinolin-3-yl]amino]phenyl]methanone |
| SMILES | COCSCn1cc(-c2ccc3cnc(Nc4ccc(C(=O)N5CC(OC)C5)cc4OC)cc3c2)cn1 |
| InChI | InChI=1S/C27H29N5O4S/c1-34-17-37-16-32-13-22(12-29-32)18-4-5-20-11-28-26(10-21(20)8-18)30-24-7-6-19(9-25(24)36-3)27(33)31-14-23(15-31)35-2/h4-13,23H,14-17H2,1-3H3,(H,28,30) |
| InChIKey | DRVNMXNOUDNIHJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|