C28H26F3N5O3 — CID 134477028
(3R,8aR)-3-[8-amino-1-[4-[1-hydroxy-1-[3-(trifluoromethyl)phenyl]ethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-6-one (PubChem CID 134477028) has the molecular formula C28H26F3N5O3 and a molecular weight of 537.54 g/mol. Its IUPAC name is (3R,8aR)-3-[8-amino-1-[4-[1-hydroxy-1-[3-(trifluoromethyl)phenyl]ethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-6-one.
| Compound Name | (3R,8aR)-3-[8-amino-1-[4-[1-hydroxy-1-[3-(trifluoromethyl)phenyl]ethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-6-one |
|---|---|
| PubChem CID | 134477028 |
| Molecular Formula | C28H26F3N5O3 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | (3R,8aR)-3-[8-amino-1-[4-[1-hydroxy-1-[3-(trifluoromethyl)phenyl]ethyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-1,3,4,7,8,8a-hexahydropyrrolo[2,1-c][1,4]oxazin-6-one |
| SMILES | CC(O)(c1ccc(-c2nc([C@H]3CN4C(=O)CC[C@@H]4CO3)n3ccnc(N)c23)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H26F3N5O3/c1-27(38,18-3-2-4-19(13-18)28(29,30)31)17-7-5-16(6-8-17)23-24-25(32)33-11-12-35(24)26(34-23)21-14-36-20(15-39-21)9-10-22(36)37/h2-8,11-13,20-21,38H,9-10,14-15H2,1H3,(H2,32,33)/t20-,21-,27?/m1/s1 |
| InChIKey | PGKUPWBQSOBJBO-NLDIKOHWSA-N |
| XLogP | 4.32 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |