About 4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol
4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol (PubChem CID 134477301) has the molecular formula C6H7F2NO
and a molecular weight of 147.12 g/mol. Its IUPAC name is 4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol |
| PubChem CID | 134477301 |
| Molecular Formula | C6H7F2NO |
| Molecular Weight | 147.12 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol |
| SMILES | NC1C=C(F)C(O)=C(F)C1 |
| InChI | InChI=1S/C6H7F2NO/c7-4-1-3(9)2-5(8)6(4)10/h1,3,10H,2,9H2 |
| InChIKey | LKHMSIVOHSPYSU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.12 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol?
The IUPAC name of 4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol (CID 134477301) is 4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol?
The canonical SMILES for 4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol is NC1C=C(F)C(O)=C(F)C1.
What is the InChIKey of 4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol?
The InChIKey is LKHMSIVOHSPYSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F2NO/c7-4-1-3(9)2-5(8)6(4)10/h1,3,10H,2,9H2.
What are the key properties of 4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol?
4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol has a molecular weight of 147.12 g/mol, XLogP of 1.31, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,6-difluorocyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 134477301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).