C30H51N — CID 134477453
(2E,6E)-9-cyclobutyl-5-[(2S)-2-[(3E)-4-ethyl-3-ethylideneheptyl]-2-methylcyclopropyl]-N,7-dimethylnona-2,6-dien-1-imine (PubChem CID 134477453) has the molecular formula C30H51N and a molecular weight of 425.75 g/mol. Its IUPAC name is (2E,6E)-9-cyclobutyl-5-[(2S)-2-[(3E)-4-ethyl-3-ethylideneheptyl]-2-methylcyclopropyl]-N,7-dimethylnona-2,6-dien-1-imine.
| Compound Name | (2E,6E)-9-cyclobutyl-5-[(2S)-2-[(3E)-4-ethyl-3-ethylideneheptyl]-2-methylcyclopropyl]-N,7-dimethylnona-2,6-dien-1-imine |
|---|---|
| PubChem CID | 134477453 |
| Molecular Formula | C30H51N |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 425.40 |
| IUPAC Name | (2E,6E)-9-cyclobutyl-5-[(2S)-2-[(3E)-4-ethyl-3-ethylideneheptyl]-2-methylcyclopropyl]-N,7-dimethylnona-2,6-dien-1-imine |
| SMILES | C/C=C(\CC[C@@]1(C)CC1C(/C=C(\C)CCC1CCC1)C/C=C/C=N/C)C(CC)CCC |
| InChI | InChI=1S/C30H51N/c1-7-13-26(8-2)27(9-3)19-20-30(5)23-29(30)28(16-10-11-21-31-6)22-24(4)17-18-25-14-12-15-25/h9-11,21-22,25-26,28-29H,7-8,12-20,23H2,1-6H3/b11-10+,24-22+,27-9+,31-21+/t26?,28?,29?,30-/m0/s1 |
| InChIKey | ALTTVCPFHYKOOI-DIYCGQQZSA-N |
| XLogP | 9.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|