C25H27F5IN5 — CID 134477456
N-[3,5-difluoro-4-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]-1-(3-iodopropyl)azetidin-3-amine (PubChem CID 134477456) has the molecular formula C25H27F5IN5 and a molecular weight of 619.42 g/mol. Its IUPAC name is N-[3,5-difluoro-4-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]-1-(3-iodopropyl)azetidin-3-amine.
| Compound Name | N-[3,5-difluoro-4-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]-1-(3-iodopropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 134477456 |
| Molecular Formula | C25H27F5IN5 |
| Molecular Weight | 619.42 g/mol |
| Exact Mass | 619.12 |
| IUPAC Name | N-[3,5-difluoro-4-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinolin-6-yl]phenyl]-1-(3-iodopropyl)azetidin-3-amine |
| SMILES | C[C@@H]1Cc2c(ccc3[nH]ncc23)[C@@H](c2c(F)cc(NC3CN(CCCI)C3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C25H27F5IN5/c1-14-7-18-17(3-4-22-19(18)10-32-34-22)24(36(14)13-25(28,29)30)23-20(26)8-15(9-21(23)27)33-16-11-35(12-16)6-2-5-31/h3-4,8-10,14,16,24,33H,2,5-7,11-13H2,1H3,(H,32,34)/t14-,24+/m1/s1 |
| InChIKey | GMCGHZVPIZLZTK-SHACYNPGSA-N |
| XLogP | 5.66 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|