C15H28N2 — CID 134477672
(4S,6R)-5-ethyl-1,4,6-trimethyl-6-[(E)-3-methylpent-2-enyl]-4,5-dihydropyridazine (PubChem CID 134477672) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (4S,6R)-5-ethyl-1,4,6-trimethyl-6-[(E)-3-methylpent-2-enyl]-4,5-dihydropyridazine.
| Compound Name | (4S,6R)-5-ethyl-1,4,6-trimethyl-6-[(E)-3-methylpent-2-enyl]-4,5-dihydropyridazine |
|---|---|
| PubChem CID | 134477672 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (4S,6R)-5-ethyl-1,4,6-trimethyl-6-[(E)-3-methylpent-2-enyl]-4,5-dihydropyridazine |
| SMILES | CC/C(C)=C/C[C@]1(C)C(CC)[C@H](C)C=NN1C |
| InChI | InChI=1S/C15H28N2/c1-7-12(3)9-10-15(5)14(8-2)13(4)11-16-17(15)6/h9,11,13-14H,7-8,10H2,1-6H3/b12-9+/t13-,14?,15-/m1/s1 |
| InChIKey | DCVBNWROQAPPQK-MIEBDTIHSA-N |
| XLogP | 4.09 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|