C23H38N2 — CID 134478085
N-propan-2-yl-1-[1-[(1R)-1-(4-propan-2-ylcyclohepta-1,3,5-trien-1-yl)ethyl]azepan-4-yl]ethanimine (PubChem CID 134478085) has the molecular formula C23H38N2 and a molecular weight of 342.57 g/mol. Its IUPAC name is N-propan-2-yl-1-[1-[(1R)-1-(4-propan-2-ylcyclohepta-1,3,5-trien-1-yl)ethyl]azepan-4-yl]ethanimine.
| Compound Name | N-propan-2-yl-1-[1-[(1R)-1-(4-propan-2-ylcyclohepta-1,3,5-trien-1-yl)ethyl]azepan-4-yl]ethanimine |
|---|---|
| PubChem CID | 134478085 |
| Molecular Formula | C23H38N2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | N-propan-2-yl-1-[1-[(1R)-1-(4-propan-2-ylcyclohepta-1,3,5-trien-1-yl)ethyl]azepan-4-yl]ethanimine |
| SMILES | C/C(=N\C(C)C)C1CCCN([C@H](C)C2=CC=C(C(C)C)C=CC2)CC1 |
| InChI | InChI=1S/C23H38N2/c1-17(2)21-9-7-10-23(13-12-21)20(6)25-15-8-11-22(14-16-25)19(5)24-18(3)4/h7,9,12-13,17-18,20,22H,8,10-11,14-16H2,1-6H3/b24-19+/t20-,22?/m1/s1 |
| InChIKey | CUIHHLMGNHBDBR-OSAJTHIESA-N |
| XLogP | 5.82 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|