C15H27N — CID 134478141
(3S)-N,3,4,4,8-pentamethyl-7-methylidenenon-8-en-2-imine (PubChem CID 134478141) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (3S)-N,3,4,4,8-pentamethyl-7-methylidenenon-8-en-2-imine.
| Compound Name | (3S)-N,3,4,4,8-pentamethyl-7-methylidenenon-8-en-2-imine |
|---|---|
| PubChem CID | 134478141 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (3S)-N,3,4,4,8-pentamethyl-7-methylidenenon-8-en-2-imine |
| SMILES | C=C(C)C(=C)CCC(C)(C)[C@H](C)/C(C)=N/C |
| InChI | InChI=1S/C15H27N/c1-11(2)12(3)9-10-15(6,7)13(4)14(5)16-8/h13H,1,3,9-10H2,2,4-8H3/b16-14+/t13-/m1/s1 |
| InChIKey | XAMVHEXBJVAHPA-ZPTIMJQQSA-N |
| XLogP | 4.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|