C25H29F3N4O2 — CID 134478286
7-(2,2-difluoroethyl)-6-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-methoxyphenyl]-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline (PubChem CID 134478286) has the molecular formula C25H29F3N4O2 and a molecular weight of 474.53 g/mol. Its IUPAC name is 7-(2,2-difluoroethyl)-6-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-methoxyphenyl]-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline.
| Compound Name | 7-(2,2-difluoroethyl)-6-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-methoxyphenyl]-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline |
|---|---|
| PubChem CID | 134478286 |
| Molecular Formula | C25H29F3N4O2 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 7-(2,2-difluoroethyl)-6-[4-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-methoxyphenyl]-3,6,8,9-tetrahydropyrazolo[4,5-f]isoquinoline |
| SMILES | COc1cc(OC2CN(CCCF)C2)ccc1C1c2ccc3[nH]ncc3c2CCN1CC(F)F |
| InChI | InChI=1S/C25H29F3N4O2/c1-33-23-11-16(34-17-13-31(14-17)9-2-8-26)3-4-20(23)25-19-5-6-22-21(12-29-30-22)18(19)7-10-32(25)15-24(27)28/h3-6,11-12,17,24-25H,2,7-10,13-15H2,1H3,(H,29,30) |
| InChIKey | ZSSKDYZCIWGLFK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 53.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |