About 4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine
4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine (PubChem CID 134478713) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine |
| PubChem CID | 134478713 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine |
| SMILES | CC1=CC(C(C)(C)C)N=C(C)N1 |
| InChI | InChI=1S/C10H18N2/c1-7-6-9(10(3,4)5)12-8(2)11-7/h6,9H,1-5H3,(H,11,12) |
| InChIKey | VXMOZAFKOJCSOB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine?
The IUPAC name of 4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine (CID 134478713) is 4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine.
What is the SMILES notation for 4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine?
The canonical SMILES for 4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine is CC1=CC(C(C)(C)C)N=C(C)N1.
What is the InChIKey of 4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine?
The InChIKey is VXMOZAFKOJCSOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-7-6-9(10(3,4)5)12-8(2)11-7/h6,9H,1-5H3,(H,11,12).
What are the key properties of 4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine?
4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine has a molecular weight of 166.27 g/mol, XLogP of 2.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2,6-dimethyl-1,4-dihydropyrimidine is sourced from PubChem (CID 134478713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).