C15H19N — CID 134478719
2,5-bis[(1Z)-buta-1,3-dienyl]-1,3,4-trimethylpyrrole (PubChem CID 134478719) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,5-bis[(1Z)-buta-1,3-dienyl]-1,3,4-trimethylpyrrole.
| Compound Name | 2,5-bis[(1Z)-buta-1,3-dienyl]-1,3,4-trimethylpyrrole |
|---|---|
| PubChem CID | 134478719 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2,5-bis[(1Z)-buta-1,3-dienyl]-1,3,4-trimethylpyrrole |
| SMILES | C=C/C=C\c1c(C)c(C)c(/C=C\C=C)n1C |
| InChI | InChI=1S/C15H19N/c1-6-8-10-14-12(3)13(4)15(16(14)5)11-9-7-2/h6-11H,1-2H2,3-5H3/b10-8-,11-9- |
| InChIKey | UEHSAHLPOSMNHB-WGEIWTTOSA-N |
| XLogP | 4.04 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|