C14H23N5O3 — CID 134479025
1-(3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-2-yl)-3-(6-isocyanatohexyl)urea (PubChem CID 134479025) has the molecular formula C14H23N5O3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-(3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-2-yl)-3-(6-isocyanatohexyl)urea.
| Compound Name | 1-(3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-2-yl)-3-(6-isocyanatohexyl)urea |
|---|---|
| PubChem CID | 134479025 |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 1-(3,6-dimethyl-4-oxo-1,2-dihydropyrimidin-2-yl)-3-(6-isocyanatohexyl)urea |
| SMILES | CC1=CC(=O)N(C)C(NC(=O)NCCCCCCN=C=O)N1 |
| InChI | InChI=1S/C14H23N5O3/c1-11-9-12(21)19(2)13(17-11)18-14(22)16-8-6-4-3-5-7-15-10-20/h9,13,17H,3-8H2,1-2H3,(H2,16,18,22) |
| InChIKey | FBCMYWKHTDARRH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|