About 6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol
6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol (PubChem CID 134479038) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol.
Molecular Properties
| Compound Name | 6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol |
| PubChem CID | 134479038 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol |
| SMILES | CC(C)(C)c1ccc2c(c1)OC(O)N2 |
| InChI | InChI=1S/C11H15NO2/c1-11(2,3)7-4-5-8-9(6-7)14-10(13)12-8/h4-6,10,12-13H,1-3H3 |
| InChIKey | IDUNTSMOQWZSJO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol?
The IUPAC name of 6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol (CID 134479038) is 6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol.
What is the SMILES notation for 6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol?
The canonical SMILES for 6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol is CC(C)(C)c1ccc2c(c1)OC(O)N2.
What is the InChIKey of 6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol?
The InChIKey is IDUNTSMOQWZSJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-11(2,3)7-4-5-8-9(6-7)14-10(13)12-8/h4-6,10,12-13H,1-3H3.
What are the key properties of 6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol?
6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol has a molecular weight of 193.25 g/mol, XLogP of 2.06, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2,3-dihydro-1,3-benzoxazol-2-ol is sourced from PubChem (CID 134479038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).