C23H24FN3O2S — CID 134479133
4-[2-(3-fluorophenyl)sulfanylpyrrol-1-yl]-2-[(4-hydroxycyclohexyl)amino]benzamide (PubChem CID 134479133) has the molecular formula C23H24FN3O2S and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-[2-(3-fluorophenyl)sulfanylpyrrol-1-yl]-2-[(4-hydroxycyclohexyl)amino]benzamide.
| Compound Name | 4-[2-(3-fluorophenyl)sulfanylpyrrol-1-yl]-2-[(4-hydroxycyclohexyl)amino]benzamide |
|---|---|
| PubChem CID | 134479133 |
| Molecular Formula | C23H24FN3O2S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 4-[2-(3-fluorophenyl)sulfanylpyrrol-1-yl]-2-[(4-hydroxycyclohexyl)amino]benzamide |
| SMILES | NC(=O)c1ccc(-n2cccc2Sc2cccc(F)c2)cc1NC1CCC(O)CC1 |
| InChI | InChI=1S/C23H24FN3O2S/c24-15-3-1-4-19(13-15)30-22-5-2-12-27(22)17-8-11-20(23(25)29)21(14-17)26-16-6-9-18(28)10-7-16/h1-5,8,11-14,16,18,26,28H,6-7,9-10H2,(H2,25,29) |
| InChIKey | VEIYVGSKFNYCFH-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |