About N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine
N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine (PubChem CID 134479249) has the molecular formula C17H28FN3
and a molecular weight of 293.43 g/mol. Its IUPAC name is N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine.
Molecular Properties
| Compound Name | N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine |
| PubChem CID | 134479249 |
| Molecular Formula | C17H28FN3 |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine |
| SMILES | C=CCC(C)C1=C(N(C)F)CN(CCC)C/C1=N\C(=C)C |
| InChI | InChI=1S/C17H28FN3/c1-7-9-14(5)17-15(19-13(3)4)11-21(10-8-2)12-16(17)20(6)18/h7,14H,1,3,8-12H2,2,4-6H3/b19-15+ |
| InChIKey | ODCRGVQCGOKVNT-XDJHFCHBSA-N |
| XLogP | 3.97 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine?
The IUPAC name of N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine (CID 134479249) is N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine.
What is the SMILES notation for N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine?
The canonical SMILES for N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine is C=CCC(C)C1=C(N(C)F)CN(CCC)C/C1=N\C(=C)C.
What is the InChIKey of N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine?
The InChIKey is ODCRGVQCGOKVNT-XDJHFCHBSA-N. The full InChI is InChI=1S/C17H28FN3/c1-7-9-14(5)17-15(19-13(3)4)11-21(10-8-2)12-16(17)20(6)18/h7,14H,1,3,8-12H2,2,4-6H3/b19-15+.
What are the key properties of N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine?
N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine has a molecular weight of 293.43 g/mol, XLogP of 3.97, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-fluoro-N-methyl-4-pent-4-en-2-yl-5-prop-1-en-2-ylimino-1-propyl-2,6-dihydropyridin-3-amine is sourced from PubChem (CID 134479249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).