C21H32N2 — CID 134479440
(3Z,4Z)-3-[1-(6-imino-2,4,4-trimethylcyclohexen-1-yl)ethylidene]-N-propylhepta-1,4,6-trien-2-amine (PubChem CID 134479440) has the molecular formula C21H32N2 and a molecular weight of 312.50 g/mol. Its IUPAC name is (3Z,4Z)-3-[1-(6-imino-2,4,4-trimethylcyclohexen-1-yl)ethylidene]-N-propylhepta-1,4,6-trien-2-amine.
| Compound Name | (3Z,4Z)-3-[1-(6-imino-2,4,4-trimethylcyclohexen-1-yl)ethylidene]-N-propylhepta-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 134479440 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | (3Z,4Z)-3-[1-(6-imino-2,4,4-trimethylcyclohexen-1-yl)ethylidene]-N-propylhepta-1,4,6-trien-2-amine |
| SMILES | CCCNC(=C)/C(=C(/C)\C1=C(CC(CC1=N)(C)C)C)/C=C\C=C |
| InChI | InChI=1S/C21H32N2/c1-8-10-11-18(17(5)23-12-9-2)16(4)20-15(3)13-21(6,7)14-19(20)22/h8,10-11,22-23H,1,5,9,12-14H2,2-4,6-7H3/b11-10-,18-16-,22-19? |
| InChIKey | YNARKBJTZYSDGK-VONSECNUSA-N |
| XLogP | 6.10 |
| TPSA | 35.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | 583 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|