C35H39N5O7 — CID 134479552
1-(2,2-dimethylpropanoyloxy)ethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate (PubChem CID 134479552) has the molecular formula C35H39N5O7 and a molecular weight of 641.73 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyloxy)ethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate.
| Compound Name | 1-(2,2-dimethylpropanoyloxy)ethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134479552 |
| Molecular Formula | C35H39N5O7 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | 1-(2,2-dimethylpropanoyloxy)ethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc(C=C)c(OC)cc2-c2ccc(C(=O)NCC3CC3)nc2C(=O)OC(C)OC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C35H39N5O7/c1-7-21-16-26(31(41)39-23-12-10-22(11-13-23)30(36)37)25(17-28(21)45-6)24-14-15-27(32(42)38-18-20-8-9-20)40-29(24)33(43)46-19(2)47-34(44)35(3,4)5/h7,10-17,19-20H,1,8-9,18H2,2-6H3,(H3,36,37)(H,38,42)(H,39,41) |
| InChIKey | JBUUUXPBIOOLBC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 182.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|