C34H37N5O7 — CID 134479572
2,2-dimethylpropanoyloxymethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate (PubChem CID 134479572) has the molecular formula C34H37N5O7 and a molecular weight of 627.70 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134479572 |
| Molecular Formula | C34H37N5O7 |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.27 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc(C=C)c(OC)cc2-c2ccc(C(=O)NCC3CC3)nc2C(=O)OCOC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C34H37N5O7/c1-6-20-15-25(30(40)38-22-11-9-21(10-12-22)29(35)36)24(16-27(20)44-5)23-13-14-26(31(41)37-17-19-7-8-19)39-28(23)32(42)45-18-46-33(43)34(2,3)4/h6,9-16,19H,1,7-8,17-18H2,2-5H3,(H3,35,36)(H,37,41)(H,38,40) |
| InChIKey | HQOVLFVEQSKXCL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 182.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|