C32H35N5O7 — CID 134479573
2-(1-hydroxyethoxy)ethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate (PubChem CID 134479573) has the molecular formula C32H35N5O7 and a molecular weight of 601.66 g/mol. Its IUPAC name is 2-(1-hydroxyethoxy)ethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate.
| Compound Name | 2-(1-hydroxyethoxy)ethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134479573 |
| Molecular Formula | C32H35N5O7 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 2-(1-hydroxyethoxy)ethyl 3-[2-[(4-carbamimidoylphenyl)carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2cc(C=C)c(OC)cc2-c2ccc(C(=O)NCC3CC3)nc2C(=O)OCCOC(C)O)cc1 |
| InChI | InChI=1S/C32H35N5O7/c1-4-20-15-25(30(39)36-22-9-7-21(8-10-22)29(33)34)24(16-27(20)42-3)23-11-12-26(31(40)35-17-19-5-6-19)37-28(23)32(41)44-14-13-43-18(2)38/h4,7-12,15-16,18-19,38H,1,5-6,13-14,17H2,2-3H3,(H3,33,34)(H,35,40)(H,36,39) |
| InChIKey | VEPMYLMPYRVWPU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 185.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|