C17H21ClN6OS2 — CID 134480114
(5S)-5-[5-[4-[amino-[(Z)-2-aminoethenyl]amino]phenyl]-3-chlorothiophen-2-yl]-2,5-dimethyl-1-oxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 134480114) has the molecular formula C17H21ClN6OS2 and a molecular weight of 424.98 g/mol. Its IUPAC name is (5S)-5-[5-[4-[amino-[(Z)-2-aminoethenyl]amino]phenyl]-3-chlorothiophen-2-yl]-2,5-dimethyl-1-oxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[5-[4-[amino-[(Z)-2-aminoethenyl]amino]phenyl]-3-chlorothiophen-2-yl]-2,5-dimethyl-1-oxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 134480114 |
| Molecular Formula | C17H21ClN6OS2 |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | (5S)-5-[5-[4-[amino-[(Z)-2-aminoethenyl]amino]phenyl]-3-chlorothiophen-2-yl]-2,5-dimethyl-1-oxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2sc(-c3ccc(N(N)/C=C\N)cc3)cc2Cl)CS1=O |
| InChI | InChI=1S/C17H21ClN6OS2/c1-17(10-27(25)23(2)16(20)22-17)15-13(18)9-14(26-15)11-3-5-12(6-4-11)24(21)8-7-19/h3-9H,10,19,21H2,1-2H3,(H2,20,22)/b8-7-/t17-,27?/m0/s1 |
| InChIKey | AYXOUDMIVYGADR-XZMUSEIZSA-N |
| XLogP | 2.32 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|