C14H23NO3 — CID 134480146
3-(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)-2,2-dimethylbutanal (PubChem CID 134480146) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)-2,2-dimethylbutanal.
| Compound Name | 3-(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)-2,2-dimethylbutanal |
|---|---|
| PubChem CID | 134480146 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 3-(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)-2,2-dimethylbutanal |
| SMILES | CCC(C)C1CC(=O)N(C(C)C(C)(C)C=O)C1=O |
| InChI | InChI=1S/C14H23NO3/c1-6-9(2)11-7-12(17)15(13(11)18)10(3)14(4,5)8-16/h8-11H,6-7H2,1-5H3 |
| InChIKey | TXNPRCGEXKOIIZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|