About 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine
5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine (PubChem CID 134480329) has the molecular formula C16H15F2N5
and a molecular weight of 315.33 g/mol. Its IUPAC name is 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine |
| PubChem CID | 134480329 |
| Molecular Formula | C16H15F2N5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine |
| SMILES | Nc1cc2nc(N3CCCC3c3cc(F)ccc3F)ccn2n1 |
| InChI | InChI=1S/C16H15F2N5/c17-10-3-4-12(18)11(8-10)13-2-1-6-22(13)15-5-7-23-16(20-15)9-14(19)21-23/h3-5,7-9,13H,1-2,6H2,(H2,19,21) |
| InChIKey | LRYFLXCAOAMPRO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine?
The IUPAC name of 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine (CID 134480329) is 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine.
What is the SMILES notation for 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine?
The canonical SMILES for 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine is Nc1cc2nc(N3CCCC3c3cc(F)ccc3F)ccn2n1.
What is the InChIKey of 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine?
The InChIKey is LRYFLXCAOAMPRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2N5/c17-10-3-4-12(18)11(8-10)13-2-1-6-22(13)15-5-7-23-16(20-15)9-14(19)21-23/h3-5,7-9,13H,1-2,6H2,(H2,19,21).
What are the key properties of 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine?
5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine has a molecular weight of 315.33 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-2-amine is sourced from PubChem (CID 134480329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).