C18H20FN5O2S2 — CID 134480489
(5S)-5-[3-fluoro-5-[5-(1H-pyrazol-5-yl)cyclohexa-2,4-dien-1-yl]thiophen-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 134480489) has the molecular formula C18H20FN5O2S2 and a molecular weight of 421.52 g/mol. Its IUPAC name is (5S)-5-[3-fluoro-5-[5-(1H-pyrazol-5-yl)cyclohexa-2,4-dien-1-yl]thiophen-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[3-fluoro-5-[5-(1H-pyrazol-5-yl)cyclohexa-2,4-dien-1-yl]thiophen-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 134480489 |
| Molecular Formula | C18H20FN5O2S2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | (5S)-5-[3-fluoro-5-[5-(1H-pyrazol-5-yl)cyclohexa-2,4-dien-1-yl]thiophen-2-yl]-2,5-dimethyl-1,1-dioxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | CN1C(N)=N[C@](C)(c2sc(C3C=CC=C(c4ccn[nH]4)C3)cc2F)CS1(=O)=O |
| InChI | InChI=1S/C18H20FN5O2S2/c1-18(10-28(25,26)24(2)17(20)22-18)16-13(19)9-15(27-16)12-5-3-4-11(8-12)14-6-7-21-23-14/h3-7,9,12H,8,10H2,1-2H3,(H2,20,22)(H,21,23)/t12?,18-/m0/s1 |
| InChIKey | HMQLLOVWQFGWPO-ZJFPTPTDSA-N |
| XLogP | 2.54 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |