C17H16F2N6S — CID 134480514
2-amino-5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carbothioamide (PubChem CID 134480514) has the molecular formula C17H16F2N6S and a molecular weight of 374.42 g/mol. Its IUPAC name is 2-amino-5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carbothioamide.
| Compound Name | 2-amino-5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carbothioamide |
|---|---|
| PubChem CID | 134480514 |
| Molecular Formula | C17H16F2N6S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-amino-5-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carbothioamide |
| SMILES | NC(=S)c1c(N)nn2ccc(N3CCCC3c3cc(F)ccc3F)nc12 |
| InChI | InChI=1S/C17H16F2N6S/c18-9-3-4-11(19)10(8-9)12-2-1-6-24(12)13-5-7-25-17(22-13)14(16(21)26)15(20)23-25/h3-5,7-8,12H,1-2,6H2,(H2,20,23)(H2,21,26) |
| InChIKey | OXMXXXUBBHALNH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|