C17H31NO3 — CID 134480941
1-(3-hydroxypyrrolidin-1-yl)tridecane-1,12-dione (PubChem CID 134480941) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is 1-(3-hydroxypyrrolidin-1-yl)tridecane-1,12-dione.
| Compound Name | 1-(3-hydroxypyrrolidin-1-yl)tridecane-1,12-dione |
|---|---|
| PubChem CID | 134480941 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 1-(3-hydroxypyrrolidin-1-yl)tridecane-1,12-dione |
| SMILES | CC(=O)CCCCCCCCCCC(=O)N1CCC(O)C1 |
| InChI | InChI=1S/C17H31NO3/c1-15(19)10-8-6-4-2-3-5-7-9-11-17(21)18-13-12-16(20)14-18/h16,20H,2-14H2,1H3 |
| InChIKey | BPPPJFXEOUEFTO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|