About 2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine
2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine (PubChem CID 134480963) has the molecular formula C9H7FN6S
and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine.
Molecular Properties
| Compound Name | 2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine |
| PubChem CID | 134480963 |
| Molecular Formula | C9H7FN6S |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine |
| SMILES | Fc1nc(NCc2nccs2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C9H7FN6S/c10-9-15-7(6-8(16-9)14-4-13-6)12-3-5-11-1-2-17-5/h1-2,4H,3H2,(H2,12,13,14,15,16) |
| InChIKey | LRAIDTKETSHCPV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine?
The IUPAC name of 2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine (CID 134480963) is 2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine.
What is the SMILES notation for 2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine?
The canonical SMILES for 2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine is Fc1nc(NCc2nccs2)c2[nH]cnc2n1.
What is the InChIKey of 2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine?
The InChIKey is LRAIDTKETSHCPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN6S/c10-9-15-7(6-8(16-9)14-4-13-6)12-3-5-11-1-2-17-5/h1-2,4H,3H2,(H2,12,13,14,15,16).
What are the key properties of 2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine?
2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine has a molecular weight of 250.26 g/mol, XLogP of 1.56, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-(1,3-thiazol-2-ylmethyl)-7H-purin-6-amine is sourced from PubChem (CID 134480963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).