About 2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole
2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole (PubChem CID 134480983) has the molecular formula C15H21NOS
and a molecular weight of 263.41 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole |
| PubChem CID | 134480983 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole |
| SMILES | CC(C)(CCC(C)(C)c1nccs1)c1ccco1 |
| InChI | InChI=1S/C15H21NOS/c1-14(2,12-6-5-10-17-12)7-8-15(3,4)13-16-9-11-18-13/h5-6,9-11H,7-8H2,1-4H3 |
| InChIKey | HHRFVJBUKIYQQS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole?
The IUPAC name of 2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole (CID 134480983) is 2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole.
What is the SMILES notation for 2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole?
The canonical SMILES for 2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole is CC(C)(CCC(C)(C)c1nccs1)c1ccco1.
What is the InChIKey of 2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole?
The InChIKey is HHRFVJBUKIYQQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NOS/c1-14(2,12-6-5-10-17-12)7-8-15(3,4)13-16-9-11-18-13/h5-6,9-11H,7-8H2,1-4H3.
What are the key properties of 2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole?
2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole has a molecular weight of 263.41 g/mol, XLogP of 4.77, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(furan-2-yl)-2,5-dimethylhexan-2-yl]-1,3-thiazole is sourced from PubChem (CID 134480983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).