C9H6N4S — CID 134481281
8-thia-4,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-6-amine (PubChem CID 134481281) has the molecular formula C9H6N4S and a molecular weight of 202.24 g/mol. Its IUPAC name is 8-thia-4,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-6-amine.
| Compound Name | 8-thia-4,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 134481281 |
| Molecular Formula | C9H6N4S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 8-thia-4,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-6-amine |
| SMILES | Nc1nncc2c1sc1ncccc12 |
| InChI | InChI=1S/C9H6N4S/c10-8-7-6(4-12-13-8)5-2-1-3-11-9(5)14-7/h1-4H,(H2,10,13) |
| InChIKey | CRKHLEUERLPLIG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |