C35H32N6O7 — CID 134481329
2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione (PubChem CID 134481329) has the molecular formula C35H32N6O7 and a molecular weight of 648.68 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134481329 |
| Molecular Formula | C35H32N6O7 |
| Molecular Weight | 648.68 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[2-[2-[2-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCOCCOCCOc4ccc(-c5ccc6c(c5)[nH]c5ccncc56)cn4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C35H32N6O7/c42-30-8-7-29(33(43)40-30)41-34(44)24-2-1-3-27(32(24)35(41)45)37-12-13-46-14-15-47-16-17-48-31-9-5-22(19-38-31)21-4-6-23-25-20-36-11-10-26(25)39-28(23)18-21/h1-6,9-11,18-20,29,37,39H,7-8,12-17H2,(H,40,42,43) |
| InChIKey | NREONVGYYJVMFO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 164.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.68 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|