About 3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol
3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol (PubChem CID 134481367) has the molecular formula C20H17N3O2
and a molecular weight of 331.38 g/mol. Its IUPAC name is 3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol |
| PubChem CID | 134481367 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol |
| SMILES | OC1CC(Oc2ccc(-c3ccc4c(c3)[nH]c3ccncc34)cn2)C1 |
| InChI | InChI=1S/C20H17N3O2/c24-14-8-15(9-14)25-20-4-2-13(10-22-20)12-1-3-16-17-11-21-6-5-18(17)23-19(16)7-12/h1-7,10-11,14-15,23-24H,8-9H2 |
| InChIKey | BPYUEQNNBURAKN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol?
The IUPAC name of 3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol (CID 134481367) is 3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol.
What is the SMILES notation for 3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol?
The canonical SMILES for 3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol is OC1CC(Oc2ccc(-c3ccc4c(c3)[nH]c3ccncc34)cn2)C1.
What is the InChIKey of 3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol?
The InChIKey is BPYUEQNNBURAKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O2/c24-14-8-15(9-14)25-20-4-2-13(10-22-20)12-1-3-16-17-11-21-6-5-18(17)23-19(16)7-12/h1-7,10-11,14-15,23-24H,8-9H2.
What are the key properties of 3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol?
3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol has a molecular weight of 331.38 g/mol, XLogP of 3.68, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]cyclobutan-1-ol is sourced from PubChem (CID 134481367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).