C33H35F2N3O8 — CID 134481404
5-[2,3-difluoro-4-(4-nitro-3-pyridinyl)phenyl]-2-[2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]pyridine (PubChem CID 134481404) has the molecular formula C33H35F2N3O8 and a molecular weight of 639.65 g/mol. Its IUPAC name is 5-[2,3-difluoro-4-(4-nitro-3-pyridinyl)phenyl]-2-[2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]pyridine.
| Compound Name | 5-[2,3-difluoro-4-(4-nitro-3-pyridinyl)phenyl]-2-[2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]pyridine |
|---|---|
| PubChem CID | 134481404 |
| Molecular Formula | C33H35F2N3O8 |
| Molecular Weight | 639.65 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | 5-[2,3-difluoro-4-(4-nitro-3-pyridinyl)phenyl]-2-[2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]pyridine |
| SMILES | O=[N+]([O-])c1ccncc1-c1ccc(-c2ccc(OCCOCCOCCOCCOCCOCc3ccccc3)nc2)c(F)c1F |
| InChI | InChI=1S/C33H35F2N3O8/c34-32-27(7-8-28(33(32)35)29-23-36-11-10-30(29)38(39)40)26-6-9-31(37-22-26)46-21-20-44-17-16-42-13-12-41-14-15-43-18-19-45-24-25-4-2-1-3-5-25/h1-11,22-23H,12-21,24H2 |
| InChIKey | KBDPXWDPHRLDJQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 124.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|