C40H40FN5O10 — CID 134481471
2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-[2-[2-[[5-(4-fluoro-5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione (PubChem CID 134481471) has the molecular formula C40H40FN5O10 and a molecular weight of 769.78 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-[2-[2-[[5-(4-fluoro-5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-[2-[2-[[5-(4-fluoro-5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134481471 |
| Molecular Formula | C40H40FN5O10 |
| Molecular Weight | 769.78 g/mol |
| Exact Mass | 769.28 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[2-[2-[2-[2-[[5-(4-fluoro-5-methylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]isoindole-1,3-dione |
| SMILES | Cn1c2cc(-c3ccc(OCCOCCOCCOCCOCCOc4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)nc3)ccc2c2cncc(F)c21 |
| InChI | InChI=1S/C40H40FN5O10/c1-45-34-20-25(2-5-28(34)31-23-42-24-32(41)37(31)45)26-3-9-36(43-22-26)56-19-17-54-15-13-52-11-10-51-12-14-53-16-18-55-27-4-6-29-30(21-27)40(50)46(39(29)49)33-7-8-35(47)44-38(33)48/h2-6,9,20-24,33H,7-8,10-19H2,1H3,(H,44,47,48) |
| InChIKey | JBYYGUJXQQZHNG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 169.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|