C39H42N6O8 — CID 134481486
3-[3-oxo-7-[2-[2-[2-[2-[2-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 134481486) has the molecular formula C39H42N6O8 and a molecular weight of 722.80 g/mol. Its IUPAC name is 3-[3-oxo-7-[2-[2-[2-[2-[2-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[2-[2-[2-[2-[2-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 134481486 |
| Molecular Formula | C39H42N6O8 |
| Molecular Weight | 722.80 g/mol |
| Exact Mass | 722.31 |
| IUPAC Name | 3-[3-oxo-7-[2-[2-[2-[2-[2-[[5-(5H-pyrido[4,3-b]indol-7-yl)-2-pyridinyl]oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylamino]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(NCCOCCOCCOCCOCCOc4ccc(-c5ccc6c(c5)[nH]c5ccncc56)cn4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C39H42N6O8/c46-36-8-7-35(38(47)44-36)45-25-31-29(39(45)48)2-1-3-32(31)41-12-13-49-14-15-50-16-17-51-18-19-52-20-21-53-37-9-5-27(23-42-37)26-4-6-28-30-24-40-11-10-33(30)43-34(28)22-26/h1-6,9-11,22-24,35,41,43H,7-8,12-21,25H2,(H,44,46,47) |
| InChIKey | VVVZSTLYYAJFAT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 166.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|