C43H44F3N7O5 — CID 134481502
2-(2,6-dioxopiperidin-3-yl)-5-[5-[4-[3-[5-(5-methylpyrido[4,3-b]indol-7-yl)-3-(trifluoromethyl)-2-pyridinyl]propyl]piperazin-1-yl]pentoxy]isoindole-1,3-dione (PubChem CID 134481502) has the molecular formula C43H44F3N7O5 and a molecular weight of 795.86 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[5-[4-[3-[5-(5-methylpyrido[4,3-b]indol-7-yl)-3-(trifluoromethyl)-2-pyridinyl]propyl]piperazin-1-yl]pentoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[5-[4-[3-[5-(5-methylpyrido[4,3-b]indol-7-yl)-3-(trifluoromethyl)-2-pyridinyl]propyl]piperazin-1-yl]pentoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134481502 |
| Molecular Formula | C43H44F3N7O5 |
| Molecular Weight | 795.86 g/mol |
| Exact Mass | 795.34 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[5-[4-[3-[5-(5-methylpyrido[4,3-b]indol-7-yl)-3-(trifluoromethyl)-2-pyridinyl]propyl]piperazin-1-yl]pentoxy]isoindole-1,3-dione |
| SMILES | Cn1c2ccncc2c2ccc(-c3cnc(CCCN4CCN(CCCCCOc5ccc6c(c5)C(=O)N(C5CCC(=O)NC5=O)C6=O)CC4)c(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C43H44F3N7O5/c1-50-36-13-14-47-26-33(36)30-9-7-27(23-38(30)50)28-22-34(43(44,45)46)35(48-25-28)6-5-16-52-19-17-51(18-20-52)15-3-2-4-21-58-29-8-10-31-32(24-29)42(57)53(41(31)56)37-11-12-39(54)49-40(37)55/h7-10,13-14,22-26,37H,2-6,11-12,15-21H2,1H3,(H,49,54,55) |
| InChIKey | NAXVDGXEPMYEMD-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.86 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|