About 6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol
6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol (PubChem CID 134481660) has the molecular formula C17H25BrF3NO5
and a molecular weight of 460.29 g/mol. Its IUPAC name is 6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol.
Molecular Properties
| Compound Name | 6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol |
| PubChem CID | 134481660 |
| Molecular Formula | C17H25BrF3NO5 |
| Molecular Weight | 460.29 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol |
| SMILES | OC(CCCCOCCOCCOCCOc1ccc(Br)cn1)C(F)(F)F |
| InChI | InChI=1S/C17H25BrF3NO5/c18-14-4-5-16(22-13-14)27-12-11-26-10-9-25-8-7-24-6-2-1-3-15(23)17(19,20)21/h4-5,13,15,23H,1-3,6-12H2 |
| InChIKey | IHDJAILGYUBXBZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol?
The IUPAC name of 6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol (CID 134481660) is 6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol.
What is the SMILES notation for 6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol?
The canonical SMILES for 6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol is OC(CCCCOCCOCCOCCOc1ccc(Br)cn1)C(F)(F)F.
What is the InChIKey of 6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol?
The InChIKey is IHDJAILGYUBXBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25BrF3NO5/c18-14-4-5-16(22-13-14)27-12-11-26-10-9-25-8-7-24-6-2-1-3-15(23)17(19,20)21/h4-5,13,15,23H,1-3,6-12H2.
What are the key properties of 6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol?
6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol has a molecular weight of 460.29 g/mol, XLogP of 3.37, 15 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-[2-[2-[(5-bromo-2-pyridinyl)oxy]ethoxy]ethoxy]ethoxy]-1,1,1-trifluorohexan-2-ol is sourced from PubChem (CID 134481660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).