C20H26N2 — CID 13448204
1,11-dimethyl-1,11-diazacycloicosa-3,8,13,18-tetrayne (PubChem CID 13448204) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1,11-dimethyl-1,11-diazacycloicosa-3,8,13,18-tetrayne.
| Compound Name | 1,11-dimethyl-1,11-diazacycloicosa-3,8,13,18-tetrayne |
|---|---|
| PubChem CID | 13448204 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1,11-dimethyl-1,11-diazacycloicosa-3,8,13,18-tetrayne |
| SMILES | CN1CC#CCCCC#CCN(C)CC#CCCCC#CC1 |
| InChI | InChI=1S/C20H26N2/c1-21-17-13-9-5-3-7-11-15-19-22(2)20-16-12-8-4-6-10-14-18-21/h3-8,17-20H2,1-2H3 |
| InChIKey | KHMIWKJMYLGDCY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|