About trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane
trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane (PubChem CID 13448214) has the molecular formula C10H18OSi
and a molecular weight of 182.34 g/mol. Its IUPAC name is trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane.
Molecular Properties
| Compound Name | trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane |
| PubChem CID | 13448214 |
| Molecular Formula | C10H18OSi |
| Molecular Weight | 182.34 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane |
| SMILES | CC1C=C(O[Si](C)(C)C)C=CC1 |
| InChI | InChI=1S/C10H18OSi/c1-9-6-5-7-10(8-9)11-12(2,3)4/h5,7-9H,6H2,1-4H3 |
| InChIKey | DLCILJVBZFYBTG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane?
The IUPAC name of trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane (CID 13448214) is trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane.
What is the SMILES notation for trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane?
The canonical SMILES for trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane is CC1C=C(O[Si](C)(C)C)C=CC1.
What is the InChIKey of trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane?
The InChIKey is DLCILJVBZFYBTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18OSi/c1-9-6-5-7-10(8-9)11-12(2,3)4/h5,7-9H,6H2,1-4H3.
What are the key properties of trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane?
trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane has a molecular weight of 182.34 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(3-methylcyclohexa-1,5-dien-1-yl)oxysilane is sourced from PubChem (CID 13448214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).