About 1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine
1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine (PubChem CID 134482330) has the molecular formula C22H44N2
and a molecular weight of 336.61 g/mol. Its IUPAC name is 1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine.
Molecular Properties
| Compound Name | 1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine |
| PubChem CID | 134482330 |
| Molecular Formula | C22H44N2 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 336.35 |
| IUPAC Name | 1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine |
| SMILES | C=CC(CCCCCC(C)C)CC(C)N(C)C(=C)NC(C)CCC |
| InChI | InChI=1S/C22H44N2/c1-9-14-19(5)23-21(7)24(8)20(6)17-22(10-2)16-13-11-12-15-18(3)4/h10,18-20,22-23H,2,7,9,11-17H2,1,3-6,8H3 |
| InChIKey | UJTGEXJQLCIPNQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine?
The IUPAC name of 1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine (CID 134482330) is 1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine.
What is the SMILES notation for 1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine?
The canonical SMILES for 1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine is C=CC(CCCCCC(C)C)CC(C)N(C)C(=C)NC(C)CCC.
What is the InChIKey of 1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine?
The InChIKey is UJTGEXJQLCIPNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44N2/c1-9-14-19(5)23-21(7)24(8)20(6)17-22(10-2)16-13-11-12-15-18(3)4/h10,18-20,22-23H,2,7,9,11-17H2,1,3-6,8H3.
What are the key properties of 1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine?
1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine has a molecular weight of 336.61 g/mol, XLogP of 6.35, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-(4-ethenyl-10-methylundecan-2-yl)-1-N'-methyl-1-N-pentan-2-ylethene-1,1-diamine is sourced from PubChem (CID 134482330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).