About 2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole
2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole (PubChem CID 134482634) has the molecular formula C23H13N3OS
and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole |
| PubChem CID | 134482634 |
| Molecular Formula | C23H13N3OS |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole |
| SMILES | c1cnc2cc(-c3nc4ccc(-c5nc6ccccc6o5)cc4s3)ccc2c1 |
| InChI | InChI=1S/C23H13N3OS/c1-2-6-20-17(5-1)25-22(27-20)15-9-10-18-21(13-15)28-23(26-18)16-8-7-14-4-3-11-24-19(14)12-16/h1-13H |
| InChIKey | IRBHXIVYELGYSD-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole?
The IUPAC name of 2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole (CID 134482634) is 2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole.
What is the SMILES notation for 2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole?
The canonical SMILES for 2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole is c1cnc2cc(-c3nc4ccc(-c5nc6ccccc6o5)cc4s3)ccc2c1.
What is the InChIKey of 2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole?
The InChIKey is IRBHXIVYELGYSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13N3OS/c1-2-6-20-17(5-1)25-22(27-20)15-9-10-18-21(13-15)28-23(26-18)16-8-7-14-4-3-11-24-19(14)12-16/h1-13H.
What are the key properties of 2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole?
2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole has a molecular weight of 379.44 g/mol, XLogP of 6.32, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-quinolin-7-yl-1,3-benzothiazol-6-yl)-1,3-benzoxazole is sourced from PubChem (CID 134482634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).