C8H13NO2S — CID 134482835
(3E,5Z)-N-methylhepta-1,3,5-triene-4-sulfonamide (PubChem CID 134482835) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is (3E,5Z)-N-methylhepta-1,3,5-triene-4-sulfonamide.
| Compound Name | (3E,5Z)-N-methylhepta-1,3,5-triene-4-sulfonamide |
|---|---|
| PubChem CID | 134482835 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | (3E,5Z)-N-methylhepta-1,3,5-triene-4-sulfonamide |
| SMILES | C=C/C=C(\C=C/C)S(=O)(=O)NC |
| InChI | InChI=1S/C8H13NO2S/c1-4-6-8(7-5-2)12(10,11)9-3/h4-7,9H,1H2,2-3H3/b7-5-,8-6+ |
| InChIKey | QDMUSQHOOROZIS-CGXWXWIYSA-N |
| XLogP | 1.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|