About 3-fluoroadamantan-1-ol
3-fluoroadamantan-1-ol (PubChem CID 13448360) has the molecular formula C10H15FO
and a molecular weight of 170.23 g/mol. Its IUPAC name is 3-fluoroadamantan-1-ol.
Molecular Properties
| Compound Name | 3-fluoroadamantan-1-ol |
| PubChem CID | 13448360 |
| Molecular Formula | C10H15FO |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-fluoroadamantan-1-ol |
| SMILES | OC12CC3CC(C1)CC(F)(C3)C2 |
| InChI | InChI=1S/C10H15FO/c11-9-2-7-1-8(3-9)5-10(12,4-7)6-9/h7-8,12H,1-6H2 |
| InChIKey | IKFPOBOOYIGIDD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoroadamantan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoroadamantan-1-ol?
The IUPAC name of 3-fluoroadamantan-1-ol (CID 13448360) is 3-fluoroadamantan-1-ol.
What is the SMILES notation for 3-fluoroadamantan-1-ol?
The canonical SMILES for 3-fluoroadamantan-1-ol is OC12CC3CC(C1)CC(F)(C3)C2.
What is the InChIKey of 3-fluoroadamantan-1-ol?
The InChIKey is IKFPOBOOYIGIDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FO/c11-9-2-7-1-8(3-9)5-10(12,4-7)6-9/h7-8,12H,1-6H2.
What are the key properties of 3-fluoroadamantan-1-ol?
3-fluoroadamantan-1-ol has a molecular weight of 170.23 g/mol, XLogP of 2.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoroadamantan-1-ol is sourced from PubChem (CID 13448360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).