C24H36FN — CID 134483700
(5Z)-N-[4-[(E)-but-2-en-2-yl]-1,4-dimethylcyclobut-2-en-1-yl]-2-ethyl-2,3,3-trimethyl-4-methylideneocta-5,7-dienimidoyl fluoride (PubChem CID 134483700) has the molecular formula C24H36FN and a molecular weight of 357.56 g/mol. Its IUPAC name is (5Z)-N-[4-[(E)-but-2-en-2-yl]-1,4-dimethylcyclobut-2-en-1-yl]-2-ethyl-2,3,3-trimethyl-4-methylideneocta-5,7-dienimidoyl fluoride.
| Compound Name | (5Z)-N-[4-[(E)-but-2-en-2-yl]-1,4-dimethylcyclobut-2-en-1-yl]-2-ethyl-2,3,3-trimethyl-4-methylideneocta-5,7-dienimidoyl fluoride |
|---|---|
| PubChem CID | 134483700 |
| Molecular Formula | C24H36FN |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | (5Z)-N-[4-[(E)-but-2-en-2-yl]-1,4-dimethylcyclobut-2-en-1-yl]-2-ethyl-2,3,3-trimethyl-4-methylideneocta-5,7-dienimidoyl fluoride |
| SMILES | C=C/C=C\C(=C)C(C)(C)C(C)(CC)/C(F)=N/C1(C)C=CC1(C)/C(C)=C/C |
| InChI | InChI=1S/C24H36FN/c1-11-14-15-19(5)21(6,7)22(8,13-3)20(25)26-24(10)17-16-23(24,9)18(4)12-2/h11-12,14-17H,1,5,13H2,2-4,6-10H3/b15-14-,18-12+,26-20- |
| InChIKey | XSVQJVLCUGPZQK-VWRJSNQMSA-N |
| XLogP | 7.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|