C14H16Cl2N2O5 — CID 13448374
2,2-dichloro-N-[2,2-dimethyl-4-(4-nitrophenyl)-1,3-dioxan-5-yl]acetamide (PubChem CID 13448374) has the molecular formula C14H16Cl2N2O5 and a molecular weight of 363.20 g/mol. Its IUPAC name is 2,2-dichloro-N-[2,2-dimethyl-4-(4-nitrophenyl)-1,3-dioxan-5-yl]acetamide.
| Compound Name | 2,2-dichloro-N-[2,2-dimethyl-4-(4-nitrophenyl)-1,3-dioxan-5-yl]acetamide |
|---|---|
| PubChem CID | 13448374 |
| Molecular Formula | C14H16Cl2N2O5 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 2,2-dichloro-N-[2,2-dimethyl-4-(4-nitrophenyl)-1,3-dioxan-5-yl]acetamide |
| SMILES | CC1(C)OCC(NC(=O)C(Cl)Cl)C(c2ccc([N+](=O)[O-])cc2)O1 |
| InChI | InChI=1S/C14H16Cl2N2O5/c1-14(2)22-7-10(17-13(19)12(15)16)11(23-14)8-3-5-9(6-4-8)18(20)21/h3-6,10-12H,7H2,1-2H3,(H,17,19) |
| InChIKey | BPJFCJRFDDRMLK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|