C22H17F2N3O3 — CID 134484255
1-(5,6-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-5-hydroxy-2,3-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione (PubChem CID 134484255) has the molecular formula C22H17F2N3O3 and a molecular weight of 409.39 g/mol. Its IUPAC name is 1-(5,6-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-5-hydroxy-2,3-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione.
| Compound Name | 1-(5,6-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-5-hydroxy-2,3-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione |
|---|---|
| PubChem CID | 134484255 |
| Molecular Formula | C22H17F2N3O3 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-(5,6-difluoro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)-5-hydroxy-2,3-dihydropyrido[2,1-f][1,2,4]triazine-4,6-dione |
| SMILES | O=C1NCN(C2c3ccccc3CCc3cc(F)c(F)cc32)n2ccc(=O)c(O)c21 |
| InChI | InChI=1S/C22H17F2N3O3/c23-16-9-13-6-5-12-3-1-2-4-14(12)19(15(13)10-17(16)24)27-11-25-22(30)20-21(29)18(28)7-8-26(20)27/h1-4,7-10,19,29H,5-6,11H2,(H,25,30) |
| InChIKey | VGYNVPQRGBNDCE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |