C18H24N2 — CID 134484500
4-cyclohexa-1,3-dien-1-yl-3-methyl-2-[(1E,3E,5Z)-3-methylhepta-1,3,5-trienyl]-1,2-dihydroimidazole (PubChem CID 134484500) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-[(1E,3E,5Z)-3-methylhepta-1,3,5-trienyl]-1,2-dihydroimidazole.
| Compound Name | 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-[(1E,3E,5Z)-3-methylhepta-1,3,5-trienyl]-1,2-dihydroimidazole |
|---|---|
| PubChem CID | 134484500 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-yl-3-methyl-2-[(1E,3E,5Z)-3-methylhepta-1,3,5-trienyl]-1,2-dihydroimidazole |
| SMILES | C/C=C\C=C(C)\C=C\C1NC=C(C2=CC=CCC2)N1C |
| InChI | InChI=1S/C18H24N2/c1-4-5-9-15(2)12-13-18-19-14-17(20(18)3)16-10-7-6-8-11-16/h4-7,9-10,12-14,18-19H,8,11H2,1-3H3/b5-4-,13-12+,15-9+ |
| InChIKey | DUXJJWHBAAJEDJ-HYSOASIUSA-N |
| XLogP | 4.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|